For research use only. Not for therapeutic Use.
11β,16α,17α,21-Tetrahydroxypregna-1,4-diene-3,20-dione(CAT: R003898) is a synthetic corticosteroid derivative belonging to the glucocorticoid class. Featuring multiple hydroxyl groups and a diene system within the pregnane backbone, it exhibits potent anti-inflammatory and immunosuppressive activity. This compound is a key intermediate in the synthesis of pharmaceutical glucocorticoids and is commonly studied for its role in modulating gene expression related to immune and metabolic functions. Its well-defined stereochemistry supports targeted receptor interactions, making it valuable for drug design and receptor binding assays. It is widely used in endocrinology and inflammation research, especially in the context of corticosteroid biosynthesis and mechanism-of-action studies.
| CAS Number | 13951-70-7 |
| Synonyms | 16alpha-Hydroxyprednisolone |
| Molecular Formula | C₂₁H₂₈O₆ |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | (8S,9S,10R,11S,13S,14S,16R,17S)-11,16,17-trihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| InChI | InChI=1S/C21H28O6/c1-19-6-5-12(23)7-11(19)3-4-13-14-8-16(25)21(27,17(26)10-22)20(14,2)9-15(24)18(13)19/h5-7,13-16,18,22,24-25,27H,3-4,8-10H2,1-2H3/t13-,14-,15-,16+,18+,19-,20-,21-/m0/s1 |
| InChIKey | SEKYBDYVXDAYPY-ILNISADRSA-N |
| SMILES | CC12CC(C3C(C1CC(C2(C(=O)CO)O)O)CCC4=CC(=O)C=CC34C)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
