For research use only. Not for therapeutic Use.
10-Methylphenoxazine(Cat No.:M344146), also known as Methylene Blue, is a heterocyclic compound with a tricyclic phenothiazine ring system. It is used in various applications, including as a redox indicator, a staining agent in biology and histology, and a medication for methemoglobinemia and cyanide poisoning. Methylene Blue is also being investigated for its potential as a treatment for neurodegenerative diseases like Alzheimer’s and Parkinson’s. It works by inhibiting the aggregation of tau protein and promoting mitochondrial function. Additionally, Methylene Blue has shown promise in enhancing memory and cognitive function, making it a subject of interest in neuropharmacology research.
| CAS Number | 25782-99-4 |
| Molecular Formula | C13H11NO |
| Purity | ≥95% |
| IUPAC Name | 10-methylphenoxazine |
| InChI | InChI=1S/C13H11NO/c1-14-10-6-2-4-8-12(10)15-13-9-5-3-7-11(13)14/h2-9H,1H3 |
| InChIKey | ICFDTWPLDBJRBV-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2OC3=CC=CC=C31 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |