Home
>
Chemical Reagents>Heterocyclic Building Blocks> (1-(tert-Butoxycarbonyl)-6-methoxy-1H-indol-2-yl)boronic acid
For research use only. Not for therapeutic Use.
(1-(tert-Butoxycarbonyl)-6-methoxy-1H-indol-2-yl)boronic acid(CAT: L045063) is a high-purity boronic acid derivative featuring a protected indole core with a tert-butoxycarbonyl (Boc) group and a methoxy substitution. This versatile compound serves as a critical intermediate in pharmaceutical research and organic synthesis, particularly in the development of bioactive molecules, small-molecule inhibitors, and advanced heterocyclic frameworks. The boronic acid functionality allows for efficient cross-coupling reactions, such as Suzuki-Miyaura coupling, enabling the synthesis of complex molecules and therapeutic candidates. (1-(tert-Butoxycarbonyl)-6-methoxy-1H-indol-2-yl)boronic acid is ideal for applications in medicinal chemistry, providing stability, reactivity, and precision for academic and industrial research innovations.
| CAS Number | 850568-65-9 |
| Molecular Formula | C14H18BNO5 |
| Purity | ≥95% |
| IUPAC Name | [6-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
| InChI | InChI=1S/C14H18BNO5/c1-14(2,3)21-13(17)16-11-8-10(20-4)6-5-9(11)7-12(16)15(18)19/h5-8,18-19H,1-4H3 |
| InChIKey | ATIJYIUOXDCYTN-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=C(C=C2)OC)(O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |