1-(Piperidin-4-yl) propane-1-one (Cat No.: L007557) is a synthetic compound with potential applications in organic synthesis and chemical research. Functioning as a versatile building block, it can engage in various chemical reactions due to its distinct structure. Its mode of action involves interactions with other molecules, enabling the creation of more complex compounds. With potential pharmacological significance, it might contribute to the development of molecules for medicinal chemistry investigations, highlighting its importance in advancing synthetic chemistry and facilitating the construction of molecular frameworks with potential applications in drug discovery and material science.
Catalog Number | L007557 |
CAS Number | 86542-94-1 |
Molecular Formula | C8H15NO |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 1-piperidin-4-ylpropan-1-one |
InChI | InChI=1S/C8H15NO/c1-2-8(10)7-3-5-9-6-4-7/h7,9H,2-6H2,1H3 |
InChIKey | IKRIFOGVLOSHNH-UHFFFAOYSA-N |
SMILES | CCC(=O)C1CCNCC1 |