For research use only. Not for therapeutic Use.
1-Piperazin-1-ylacetone dihydrochloride(Cat No.:L007801), is a notable chemical compound used in various research and pharmaceutical applications. It belongs to the class of piperazine derivatives, which are widely utilized in medicinal chemistry. Piperazine derivatives often exhibit biological activity, making them valuable building blocks for drug discovery. In this specific compound, the piperazine moiety is functionalized with an acetone group, potentially imparting unique properties. Researchers employ this compound as a precursor or intermediate in the synthesis of complex organic molecules, especially in the development of new pharmaceutical agents targeting specific biological pathways. Its controlled synthesis and versatility contribute to its significance in medicinal research and drug development processes.
CAS Number | 1353504-07-0 |
Molecular Formula | C7H16Cl2N2O |
Purity | ≥95% |
IUPAC Name | 1-piperazin-1-ylpropan-2-one;dihydrochloride |
InChI | InChI=1S/C7H14N2O.2ClH/c1-7(10)6-9-4-2-8-3-5-9;;/h8H,2-6H2,1H3;2*1H |
InChIKey | UIDYHGUMBHBTCS-UHFFFAOYSA-N |
SMILES | CC(=O)CN1CCNCC1.Cl.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |