For research use only. Not for therapeutic Use.
-Phenylnaphthalene(CAT: R068996) is a chemical compound that may have relevance in organic chemistry and industrial processes. Its action method involves its potential use as a chemical intermediate, particularly in the synthesis of various organic compounds or materials. While specific applications can vary, compounds like 1-Phenylnaphthalene are often employed in organic synthesis to introduce specific structural features or functional groups into molecules.
| CAS Number | 605-02-7 |
| Synonyms | a-Phenyl naphthalene |
| Molecular Formula | C16H12 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 1-phenylnaphthalene |
| InChI | InChI=1S/C16H12/c1-2-7-13(8-3-1)16-12-6-10-14-9-4-5-11-15(14)16/h1-12H |
| InChIKey | IYDMICQAKLQHLA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC3=CC=CC=C32 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |