Home
>
Chemical Reagents>Heterocyclic Building Blocks> 1-Phenyl-4-[1,2,2-tris(4-phenylphenyl)ethenyl]benzene
For research use only. Not for therapeutic Use.
1-Phenyl-4-[1,2,2-tris(4-phenylphenyl)ethenyl]benzene (Cat.No:L003969) is a crucial compound in materials science. Its unique structure, featuring a phenyl-substituted ethenyl moiety, imparts specialized properties. This compound is utilized in the synthesis of tailored molecules with applications in organic electronics, particularly in light-emitting devices.
| CAS Number | 7146-38-5 |
| Molecular Formula | C50H36 |
| Purity | ≥95% |
| IUPAC Name | 1-phenyl-4-[1,2,2-tris(4-phenylphenyl)ethenyl]benzene |
| InChI | InChI=1S/C50H36/c1-5-13-37(14-6-1)41-21-29-45(30-22-41)49(46-31-23-42(24-32-46)38-15-7-2-8-16-38)50(47-33-25-43(26-34-47)39-17-9-3-10-18-39)48-35-27-44(28-36-48)40-19-11-4-12-20-40/h1-36H |
| InChIKey | HIAJNZGCSYPKJH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=C(C3=CC=C(C=C3)C4=CC=CC=C4)C5=CC=C(C=C5)C6=CC=CC=C6)C7=CC=C(C=C7)C8=CC=CC=C8 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |