For research use only. Not for therapeutic Use.
1-Phenanthrol (Cat No.:R008676) is a chemical compound. It is a chelating agent and ligand frequently employed in coordination chemistry and analytical applications. Due to its ability to form stable complexes with metal ions, 1-phenanthrol is utilized for detecting and quantifying metal ions in various samples. Its distinctive chelation properties make it valuable in titrations, spectrophotometry, and electrochemical analysis. Its role as a versatile ligand contributes to its significance in research and various industries, aiding in the understanding of metal ion interactions and supporting precise metal ion determination in diverse samples.
| CAS Number | 2433-56-9 |
| Synonyms | 1-Phenanthrenol; 1-Hydroxyphenanthrene; NSC 44471; |
| Molecular Formula | C14H10O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | phenanthren-1-ol |
| InChI | InChI=1S/C14H10O/c15-14-7-3-6-12-11-5-2-1-4-10(11)8-9-13(12)14/h1-9,15H |
| InChIKey | GTBXZWADMKOZQJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C=CC=C3O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
