For research use only. Not for therapeutic Use.
1-Oleoyl lysophosphatidic acid sodium salt (Cat No.:I010831) is a chemical compound derived from lysophosphatidic acid (LPA). It is the sodium salt form of 1-oleoyl LPA. This compound acts as a signaling molecule involved in various cellular processes. It has been implicated in cell proliferation, migration, and differentiation. 1-Oleoyl lysophosphatidic acid sodium salt interacts with specific G protein-coupled receptors, activating downstream signaling pathways.
CAS Number | 325465-93-8 |
Synonyms | 1-O-9Z-Octadecenoyl-sn-glyceryl-3-phosphoric acid sodium salt |
Molecular Formula | C21H40NaO7P |
Purity | ≥95% |
Target | LPL Receptor |
Solubility | Soluble to 10 mM in phosphate buffered saline |
Storage | -20°C |
IUPAC Name | sodium;[(2R)-2-hydroxy-3-[(Z)-octadec-9-enoyl]oxypropyl] hydrogen phosphate |
InChI | InChI=1S/C21H41O7P.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(23)27-18-20(22)19-28-29(24,25)26;/h9-10,20,22H,2-8,11-19H2,1H3,(H2,24,25,26);/q;+1/p-1/b10-9-;/t20-;/m1./s1 |
InChIKey | XGRLSUFHELJJAB-JGSYTFBMSA-M |
SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)[O-])O.[Na+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |