1-NM-PP1 (CAT: I002695), also known as PP1 Analog II, is a cell-permeable compound with significant implications in kinase inhibition. It serves as a potent and selective inhibitor of mutant kinases compared to their wild-type counterparts. Notably, 1-NM-PP1 effectively targets and inhibits the activity of mutant kinases, such as v-Src (IC50 = 28 μM) and v-Src-as1 I338G (IC50 = 4.2 nM). This inhibitor’s selectivity for mutant kinases over wild-type forms underscores its potential importance in cancer research and personalized medicine, where targeting specific kinase mutations can offer innovative therapeutic strategies for disease treatment and intervention.
| Catalog Number | I002695 |
| CAS Number | 221244-14-0 |
| Synonyms | 1-tert-butyl-3-(naphthalen-1-ylmethyl)pyrazolo[3,4-d]pyrimidin-4-amine |
| Molecular Formula | C20H21N5 |
| Purity | 95% |
| Target | Src |
| Solubility | DMSO: ≤ 27.5 mg/mL |
| Storage | Store at -20C |
| IC50 | 4.2 nM (v-Src-as1 I338G) [1] |
| InChI | InChI=1S/C20H21N5/c1-20(2,3)25-19-17(18(21)22-12-23-19)16(24-25)11-14-9-6-8-13-7-4-5-10-15(13)14/h4-10,12H,11H2,1-3H3,(H2,21,22,23) |
| InChIKey | GDQXJQSQYMMKRA-UHFFFAOYSA-N |
| SMILES | NC1=NC=NC2=C1C(CC3=CC=CC4=C3C=CC=C4)=NN2C(C)(C)C |
| Reference | <p style=/line-height:25px/> |
