For research use only. Not for therapeutic Use.
1-Naphthoic acid is used as an intermediate for the synthesis of various compounds.
| CAS Number | 86-55-5 |
| Synonyms | 1-Naphthoic Acid; 1-Carboxynaphthalene; 1-Naphthylcarboxylic Acid; 1-Napthanoic Acid; NSC 37569; Naphthalene-α-carboxylic Acid; α-Naphthoic Acid; α-Naphthylcarboxylic Acid |
| Molecular Formula | C11H8O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | naphthalene-1-carboxylic acid |
| InChI | InChI=1S/C11H8O2/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,(H,12,13) |
| InChIKey | LNETULKMXZVUST-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
