For research use only. Not for therapeutic Use.
1-Methylpiperidine-4-carboxylic acid(Cat No.:L024054)is a key intermediate in pharmaceutical and organic chemistry, featuring a methylated piperidine ring and a carboxylic acid functional group. Its structure makes it valuable in the synthesis of various bioactive compounds, including potential therapeutic agents. This compound is commonly used in the design of inhibitors, modulators, and ligands targeting specific receptors. Its versatility and reactivity enable it to serve as a building block in drug discovery and medicinal chemistry, facilitating the development of new molecules with enhanced pharmacological properties.
CAS Number | 68947-43-3 |
Molecular Formula | C7H13NO2 |
Purity | ≥95% |
IUPAC Name | 1-methylpiperidine-4-carboxylic acid |
InChI | InChI=1S/C7H13NO2/c1-8-4-2-6(3-5-8)7(9)10/h6H,2-5H2,1H3,(H,9,10) |
InChIKey | HCKNAJXCHMACDN-UHFFFAOYSA-N |
SMILES | CN1CCC(CC1)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |