For research use only. Not for therapeutic Use.
1-(Methylamino)propan-2-ol (Cat No.: M081974) is an organic compound featuring both a secondary amine and a secondary alcohol functional group. This colorless to pale yellow liquid is water-soluble and serves as an intermediate in pharmaceutical and fine chemical synthesis. It is structurally related to sympathomimetic agents and is used in the preparation of β-adrenergic drugs and other bioactive molecules. Its dual functionality allows for diverse chemical reactivity, making it valuable in medicinal chemistry, agrochemical development, and as a chiral building block in synthesis.
| CAS Number | 16667-45-1 |
| Molecular Formula | C4H11NO |
| Purity | ≥95% |
| Storage | Room temperature |
| IUPAC Name | 1-(methylamino)propan-2-ol |
| InChI | InChI=1S/C4H11NO/c1-4(6)3-5-2/h4-6H,3H2,1-2H3 |
| InChIKey | AEKHFLDILSDXBL-UHFFFAOYSA-N |
| SMILES | CC(CNC)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
