For research use only. Not for therapeutic Use.
1-Methyl-5-amino-1H-benzimidazole-2-butanoic acid ethyl ester (Cat No.: R004969) is a benzimidazole-based compound featuring a methylated nitrogen, an amino group at the 5-position, and an ethyl esterified butanoic acid side chain at the 2-position. This multifunctional structure provides opportunities for hydrogen bonding, alkylation, and ester hydrolysis, making it a valuable intermediate in pharmaceutical and agrochemical synthesis. Its benzimidazole core is commonly found in biologically active molecules, particularly those targeting enzymes or receptors, including antimicrobial, antiviral, and anticancer drug candidates.
| CAS Number | 3543-73-5 |
| Synonyms | 5-Amino-1-methyl-2-benzimidazolebutyric Acid Ethyl Ester; |
| Molecular Formula | C14H19N3O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | ethyl 4-(5-amino-1-methylbenzimidazol-2-yl)butanoate |
| InChI | InChI=1S/C14H19N3O2/c1-3-19-14(18)6-4-5-13-16-11-9-10(15)7-8-12(11)17(13)2/h7-9H,3-6,15H2,1-2H3 |
| InChIKey | JUMGOLYNZBZPKE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCC1=NC2=C(N1C)C=CC(=C2)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
