Home
>
Chemical Reagents>Heterocyclic Building Blocks> 1-methyl-4-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid
For research use only. Not for therapeutic Use.
1-methyl-4-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid (Cat.No:L003371) is a significant chemical compound in medicinal chemistry. Its distinctive structure and reactivity offer potential in drug development, underscoring its importance in the quest for novel pharmaceutical agents.
| CAS Number | 878204-61-6 |
| Molecular Formula | C6H5F3N2O2 |
| Purity | ≥95% |
| IUPAC Name | 1-methyl-4-(trifluoromethyl)pyrazole-3-carboxylic acid |
| InChI | InChI=1S/C6H5F3N2O2/c1-11-2-3(6(7,8)9)4(10-11)5(12)13/h2H,1H3,(H,12,13) |
| InChIKey | DDCSKHXNYGOCEB-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C(=O)O)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
