1-Methyl-2-pyrrolidinone (Cat. No: R046946) appears as a clear colorless liquid with a “fishlike” odor. It is used as a polar aprotic solvent.
| Catalog Number | R046946 |
| CAS Number | 872-50-4 |
| Synonyms | 1-Methyl-5-pyrrolidinone; 1-Methylazacyclopentan-2-one; 1-Methylpyrrolidone; AgsolEx 1; M-Pyrol; Microposit 2001; N 0131; N-Methyl-2-ketopyrrolidine; N-Methyl-γ-butyrolactam; N-Methylbutyrolactam; N-Methylpyrrolidone; NMP; NSC 4594; Pharmasolve; Pyro |
| Molecular Formula | C5H9NO |
| Purity | 95% |
| Storage | Store at -20°C |
| IUPAC Name | 1-methylpyrrolidin-2-one |
| InChI | InChI=1S/C5H9NO/c1-6-4-2-3-5(6)7/h2-4H2,1H3 |
| InChIKey | SECXISVLQFMRJM-UHFFFAOYSA-N |
| SMILES | CN1CCCC1=O |
| Reference | <span style=”color:#000000;”><span style=”font-size:12px;”><span style=”font-family:arial,helvetica,sans-serif;”>1.<span style=”font-variant-ligatures: normal; orphans: 2; widows: 2;”>Jung, Da-Won, et al. "Facile synthesis of MOF-177 by a sonochemical method using 1-methyl-2-pyrrolidinone as a solvent." </span><i style=”font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;”>Dalton Transactions</i><span style=”font-variant-ligatures: normal; orphans: 2; widows: 2;”> 39.11 (2010): 2883-2887.<br /> |
