For research use only. Not for therapeutic Use.
1-Methyl-2-benzimidazolinone(CAT: M123152) is a versatile heterocyclic compound commonly used in pharmaceutical and biochemical research. Its unique benzimidazolinone structure, featuring a methyl group at the nitrogen position, offers significant potential in medicinal chemistry. This compound serves as a precursor or intermediate in the synthesis of various bioactive molecules and drug candidates. It is particularly useful in designing enzyme inhibitors or ligands for specific receptors due to its stable and reactive framework. 1-Methyl-2-benzimidazolinone is highly valued in drug discovery, helping researchers explore innovative therapeutic options in fields such as oncology, neurology, and infectious diseases.
CAS Number | 1849-01-0 |
Molecular Formula | C8H8N2O |
Purity | ≥95% |
Storage | Desiccate at -20C |
IUPAC Name | 3-methyl-1H-benzimidazol-2-one |
InChI | InChI=1S/C8H8N2O/c1-10-7-5-3-2-4-6(7)9-8(10)11/h2-5H,1H3,(H,9,11) |
InChIKey | PYEHNKXDXBNHQQ-UHFFFAOYSA-N |
SMILES | CN1C2=CC=CC=C2NC1=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |