For research use only. Not for therapeutic Use.
1-methoxy-5-Methylphenazinium (methyl sulfate) is a photochemically stable mediator of electron transport between NADPH and various electron acceptors such as tetrazolium dyes. It can be used to visualize NAD-linked dehydrogenase activities.
CAS Number | 65162-13-2 |
Synonyms | 1-Methoxyphenazine methosulfate;1-methoxy PMS |
Molecular Formula | C14H13N2O • CH3SO4 |
Purity | ≥95% |
Target | NF-κB |
Storage | -20°C |
InChI | InChI=1S/C14H13N2O.CH4O4S/c1-16-11-7-4-3-6-10(11)15-14-12(16)8-5-9-13(14)17-2;1-5-6(2,3)4/h3-9H,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
InChIKey | MASUWVVNWALEEM-UHFFFAOYSA-M |
SMILES | COC1=CC=CC2=[N+](C)C3=CC=CC=C3N=C12.[O-]S(=O)(OC)=O |
Reference | 1.Hisada, R. and Yagi, T. 1-Methoxy-5-methylphenazinium methyl sulfate. A photochemically stable electron mediator between NADH and various electron acceptors. J. Biochem. 82(5), 1469-1473 (1977). |