For research use only. Not for therapeutic Use.
1-Methoxy-2-propanol (Cat No.:R014816) is a chemical compound. Also known as propylene glycol monomethyl ether, it consists of a propane backbone with a methoxy (CH3O) group attached. This compound is employed in various industrial applications, including coatings, cleaning products, and as a solvent in inks and dyes. Its unique combination of properties, such as solubility and low volatility, makes it useful for formulating products that require controlled evaporation rates. Its stability and compatibility with other chemicals contribute to its role in enhancing performance and functionality in a range of commercial and industrial products.
CAS Number | 107-98-2 |
Synonyms | 1-Methoxy-2-hydroxypropane; 2-Methoxy-1-methylethanol; 3-Methoxy-2-propanol; BYK 4510; Closol; Dowanol 33B; Dowtherm 209; Methoxyisopropanol; NSC 2409; Propylene Glycol 1-Methyl Ether |
Molecular Formula | C4H10O2 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 1-methoxypropan-2-ol |
InChI | InChI=1S/C4H10O2/c1-4(5)3-6-2/h4-5H,3H2,1-2H3 |
InChIKey | ARXJGSRGQADJSQ-UHFFFAOYSA-N |
SMILES | CC(COC)O |
Reference | <p> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |