For research use only. Not for therapeutic Use.
1-Iminothiomorpholine 1-oxide hydrochloride (Cat.No:L003947) is a noteworthy chemical compound with diverse applications in medicinal chemistry. Its unique structure, featuring an iminothiomorpholine oxide group, imparts distinctive reactivity. This compound serves as a valuable intermediate in the synthesis of specialized organic molecules with various industrial and pharmaceutical applications.
CAS Number | 1633667-60-3 |
Molecular Formula | C4H11ClN2OS |
Purity | ≥95% |
IUPAC Name | 1-imino-1,4-thiazinane 1-oxide;hydrochloride |
InChI | InChI=1S/C4H10N2OS.ClH/c5-8(7)3-1-6-2-4-8;/h5-6H,1-4H2;1H |
InChIKey | FLQQIIQMFJZKQH-UHFFFAOYSA-N |
SMILES | C1CS(=N)(=O)CCN1.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |