For research use only. Not for therapeutic Use.
1-Hydroxycyclopentanecarboxylic acid is a cyclic carboxylic acid featuring a hydroxyl group and a carboxylic acid group on a cyclopentane ring. This compound is of interest in organic synthesis and medicinal chemistry due to its potential applications as a building block for pharmaceuticals and agrochemicals. Its unique structure enables various chemical modifications, enhancing its reactivity in synthetic pathways. Researchers explore its biological activities, investigating its role in developing novel compounds with therapeutic potential and understanding its interactions in biochemical systems.
CAS Number | 16841-19-3 |
Synonyms | 1-Hydroxycyclopentan-1-carboxylic Acid;?1-Hydroxycyclopentanecarboxylic Acid; NSC 64727; NSC 64918 |
Molecular Formula | C6H10O3 |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | 1-hydroxycyclopentane-1-carboxylic acid |
InChI | InChI=1S/C6H10O3/c7-5(8)6(9)3-1-2-4-6/h9H,1-4H2,(H,7,8) |
InChIKey | JJABOWZNFOCHMN-UHFFFAOYSA-N |
SMILES | C1CCC(C1)(C(=O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |