For research use only. Not for therapeutic Use.
1-Hydroxy-7-azabenzotriazole (Cat No.: R007295) is a heterocyclic compound widely used in peptide synthesis to improve coupling efficiency and minimize racemization. As a coupling additive, HOAt enhances the reactivity of carbodiimide-based reagents such as DIC or EDC by forming a reactive intermediate that facilitates amide bond formation. Its structure, featuring a triazole ring with a hydroxyl group, contributes to its nucleophilicity and stability. HOAt is preferred in solid-phase peptide synthesis (SPPS) for producing high-purity peptides and complex biomolecules with improved yields.
CAS Number | 39968-33-7 |
Synonyms | [1,2,3]Triazolo[4,5-b]pyridin-3-ol; 1H-[1,2,3]triazolo[4,5-b]pyridine 3-Oxide; HOAt. |
Molecular Formula | C5H4N4O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-hydroxytriazolo[4,5-b]pyridine |
InChI | InChI=1S/C5H4N4O/c10-9-5-4(7-8-9)2-1-3-6-5/h1-3,10H |
InChIKey | FPIRBHDGWMWJEP-UHFFFAOYSA-N |
SMILES | C1=CC2=C(N=C1)N(N=N2)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |