For research use only, not for therapeutic use.
1-Ethynyl-2,4-difluorobenzene(Cat No.:L006755). It features a benzene ring with both an ethynyl (-C≡CH) group and two fluorine atoms attached at the 2- and 4- positions. This compound is used as a building block in organic synthesis, particularly in the development of organic semiconductors and materials for optoelectronic devices. Its unique structure allows it to participate in various chemical reactions, making it valuable in the design and fabrication of advanced electronic components such as organic light-emitting diodes (OLEDs) and organic field-effect transistors (OFETs) for modern technology applications.
Catalog Number | L006755 |
CAS Number | 302912-34-1 |
Molecular Formula | C8H4F2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 1-ethynyl-2,4-difluorobenzene |
InChI | InChI=1S/C8H4F2/c1-2-6-3-4-7(9)5-8(6)10/h1,3-5H |
InChIKey | HRUJQXRGWQWYDH-UHFFFAOYSA-N |
SMILES | C#CC1=C(C=C(C=C1)F)F |