For research use only. Not for therapeutic Use.
1-(Chloromethyl)-2,3,4,5,6-pentafluorobenzene(Cat No.:L006964), is an organic compound. It is a colorless liquid featuring a chloromethyl group (CH2Cl) attached to a benzene ring where all hydrogen atoms are replaced by fluorine atoms. This compound serves as a valuable intermediate in organic synthesis, particularly in the preparation of complex organic molecules and pharmaceuticals. Its specific structure, combining fluorine substitution and a chloromethyl group, provides unique reactivity, allowing it to participate in various chemical transformations.
| CAS Number | 653-35-0 |
| Molecular Formula | C7H2ClF5 |
| Purity | ≥95% |
| IUPAC Name | 1-(chloromethyl)-2,3,4,5,6-pentafluorobenzene |
| InChI | InChI=1S/C7H2ClF5/c8-1-2-3(9)5(11)7(13)6(12)4(2)10/h1H2 |
| InChIKey | ZLNVRXFZTPRLIK-UHFFFAOYSA-N |
| SMILES | C(C1=C(C(=C(C(=C1F)F)F)F)F)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |