For research use only. Not for therapeutic Use.
1-Chloro-2-(4-ethoxybenzyl)-4-iodobenzene(Cat No.:R028958)is a halogenated aromatic compound featuring a chlorinated benzene ring substituted with a 4-ethoxybenzyl group at the 2-position and an iodine atom at the 4-position. This structure offers multiple reactive sites for further functionalization, making it a valuable intermediate in organic and medicinal chemistry. The iodine allows for cross-coupling reactions such as Suzuki or Sonogashira couplings, while the ethoxybenzyl moiety contributes to lipophilicity and electronic modulation. It is useful in the synthesis of complex molecules, including pharmaceutical candidates, agrochemicals, and functionalized aromatic systems.
| CAS Number | 1103738-29-9 |
| Molecular Formula | C15H14ClIO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-chloro-2-[(4-ethoxyphenyl)methyl]-4-iodobenzene |
| InChI | InChI=1S/C15H14ClIO/c1-2-18-14-6-3-11(4-7-14)9-12-10-13(17)5-8-15(12)16/h3-8,10H,2,9H2,1H3 |
| InChIKey | CZFRIPGHKLGMEU-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)CC2=C(C=CC(=C2)I)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |