For research use only. Not for therapeutic Use.
1-(Bromomethyl)-2-methyl-benzene (Cat. No: R023670) is a hydrocarbon halide that can be used as an intermediate in organic synthesis for the manufacture of pharmaceuticals, pharmaceuticals and organic synthesis, mainly for scientific research.
| CAS Number | 89-92-9 |
| Synonyms | α-Bromo-o-xylene; 1-(Bromomethyl)-2-methylbenzene; 2-(Bromomethyl)toluene; 2-Methylbenzyl bromide; 2-Xylyl bromide; NSC 60145; o-(Bromomethyl)toluene; o-Methylbenzyl bromide; o-Xylyl bromide; α-Bromo-o-xylene |
| Molecular Formula | C8H9Br |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-(bromomethyl)-2-methylbenzene |
| InChI | InChI=1S/C8H9Br/c1-7-4-2-3-5-8(7)6-9/h2-5H,6H2,1H3 |
| InChIKey | WGVYCXYGPNNUQA-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1CBr |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |