For research use only. Not for therapeutic Use.
1-Bromo-5-methylisoquinoline(Cat No.:L007519), is a chemical compound with a molecular structure consisting of an isoquinoline ring and a bromine atom at the 1st position, and a methyl group at the 5th position. This compound is valuable in organic synthesis and medicinal chemistry. Its unique structure and reactivity make it useful for the development of diverse organic compounds, including pharmaceuticals and materials.
CAS Number | 1535314-18-1 |
Molecular Formula | C10H8BrN |
Purity | ≥95% |
IUPAC Name | 1-bromo-5-methylisoquinoline |
InChI | InChI=1S/C10H8BrN/c1-7-3-2-4-9-8(7)5-6-12-10(9)11/h2-6H,1H3 |
InChIKey | MMXZWXWTKIXVDT-UHFFFAOYSA-N |
SMILES | CC1=C2C=CN=C(C2=CC=C1)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |