For research use only. Not for therapeutic Use.
1-Bromo-4-(propane-2-sulfonyl)benzene(Cat No.:L038674)is a high-purity compound commonly used in pharmaceutical research and organic synthesis. This brominated benzene derivative, featuring a propane-2-sulfonyl group, serves as a valuable intermediate in the development of various bioactive molecules. Its unique structure allows for selective reactions, making it essential in medicinal chemistry for synthesizing complex aromatic compounds. 1-Bromo-4-(propane-2-sulfonyl)benzene is crucial for research focused on creating new therapeutic agents and optimizing synthetic pathways, offering reliable performance in advanced chemical applications.
| CAS Number | 70399-02-9 |
| Molecular Formula | C9H11BrO2S |
| Purity | ≥95% |
| IUPAC Name | 1-bromo-4-propan-2-ylsulfonylbenzene |
| InChI | InChI=1S/C9H11BrO2S/c1-7(2)13(11,12)9-5-3-8(10)4-6-9/h3-7H,1-2H3 |
| InChIKey | WQZTWNHNXOSAAR-UHFFFAOYSA-N |
| SMILES | CC(C)S(=O)(=O)C1=CC=C(C=C1)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |