For research use only. Not for therapeutic Use.
1-Bromo-4-(methylsulfinyl)benzene(Cat No.:L020857)is an aromatic compound featuring a bromine atom at the 1-position and a methylsulfinyl group at the 4-position on the benzene ring. This compound is widely used in pharmaceutical and organic synthesis as a versatile building block for creating more complex molecules. Its structure allows for diverse chemical reactions, making it valuable in the development of bioactive compounds, including pharmaceuticals and agrochemicals. 1-Bromo-4-(methylsulfinyl)benzene is essential for researchers focused on advancing synthetic methodologies and exploring novel therapeutic agents.
CAS Number | 934-71-4 |
Molecular Formula | C7H7BrOS |
Purity | ≥95% |
IUPAC Name | 1-bromo-4-methylsulfinylbenzene |
InChI | InChI=1S/C7H7BrOS/c1-10(9)7-4-2-6(8)3-5-7/h2-5H,1H3 |
InChIKey | MPOPDYTWAYBUOD-UHFFFAOYSA-N |
SMILES | CS(=O)C1=CC=C(C=C1)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |