For research use only. Not for therapeutic Use.
1-Bromo-4-((4-fluorophenyl)sulfonyl)benzene(Cat No.:L029792)is a key intermediate in organic synthesis, particularly in pharmaceutical and materials science research. This compound features a bromine atom and a fluorophenylsulfonyl group attached to a benzene ring, offering unique reactivity for constructing complex molecular structures. It is commonly used in the development of active pharmaceutical ingredients (APIs), fine chemicals, and advanced materials. Its high purity and stability make it an essential tool for researchers and chemists involved in innovative drug discovery, chemical synthesis, and the creation of new functional materials.
CAS Number | 383-28-8 |
Molecular Formula | C12H8BrFO2S |
Purity | ≥95% |
IUPAC Name | 1-(4-bromophenyl)sulfonyl-4-fluorobenzene |
InChI | InChI=1S/C12H8BrFO2S/c13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12/h1-8H |
InChIKey | FJUPQROIJRHZJT-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1F)S(=O)(=O)C2=CC=C(C=C2)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |