For research use only. Not for therapeutic Use.
1-Bromo-3,5-di-tert-butylbenzene(Cat No.:L023386)is a brominated aromatic compound featuring bulky tert-butyl groups at the 3 and 5 positions of the benzene ring, which provide significant steric hindrance. The bromine atom at the 1-position serves as a reactive site for cross-coupling reactions, such as Suzuki or Heck coupling, making it a valuable intermediate in organic synthesis. Its high stability and hydrophobic character are advantageous in designing ligands, advanced materials, and specialty polymers. This compound is often used in the synthesis of sterically protected aromatic systems and in fine chemical development.
CAS Number | 22385-77-9 |
Molecular Formula | C14H21Br |
Purity | ≥95% |
IUPAC Name | 1-bromo-3,5-ditert-butylbenzene |
InChI | InChI=1S/C14H21Br/c1-13(2,3)10-7-11(14(4,5)6)9-12(15)8-10/h7-9H,1-6H3 |
InChIKey | BUOWTUULDKULFI-UHFFFAOYSA-N |
SMILES | CC(C)(C)C1=CC(=CC(=C1)Br)C(C)(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |