For research use only. Not for therapeutic Use.
1-Bromo-3-(methoxymethoxy)naphthalene(CAT: L000020) is a key chemical compound with applications primarily in organic chemistry. It serves as an important intermediate for the synthesis of various organic compounds, enabling the diversification of chemical synthesis. Its unique structure and bromine functional group provide opportunities for creating specialized molecules with potential uses in various fields within organic chemistry.
CAS Number | 2158303-49-0 |
Molecular Formula | C12H11BrO2 |
Purity | ≥95% |
IUPAC Name | 1-bromo-3-(methoxymethoxy)naphthalene |
InChI | InChI=1S/C12H11BrO2/c1-14-8-15-10-6-9-4-2-3-5-11(9)12(13)7-10/h2-7H,8H2,1H3 |
InChIKey | SYTVTPAROOODCH-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |