For research use only. Not for therapeutic Use.
1-Bromo-3-(difluoromethyl)-5-fluorobenzene(Cat No.:L036765)is a high-purity aromatic compound commonly used in pharmaceutical and chemical research. This molecule features a bromine atom, a difluoromethyl group, and a fluorine atom on a benzene ring, making it a versatile intermediate in the synthesis of bioactive molecules, including potential drug candidates. Its unique structure allows for selective reactivity in various chemical transformations, facilitating the development of novel therapeutic agents. 1-Bromo-3-(difluoromethyl)-5-fluorobenzene is essential for precise synthetic applications in medicinal chemistry and advanced research.
CAS Number | 627526-90-3 |
Molecular Formula | C7H4BrF3 |
Purity | ≥95% |
IUPAC Name | 1-bromo-3-(difluoromethyl)-5-fluorobenzene |
InChI | InChI=1S/C7H4BrF3/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,7H |
InChIKey | OPTDWHOFDCKSSE-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1F)Br)C(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |