For research use only. Not for therapeutic Use.
1-Bromo-3-chloro-4-methylisoquinoline(CAT: L025562) is a high-purity heterocyclic compound featuring a bromine and chlorine substitution on an isoquinoline core, along with a methyl group at the 4-position. This versatile molecule is widely used in pharmaceutical and chemical research as a key intermediate for synthesizing complex organic compounds and bioactive molecules. Its unique structure and reactivity make it valuable in medicinal chemistry for the development of novel therapeutic agents and in studying structure-activity relationships. With consistent quality and excellent stability, 1-Bromo-3-chloro-4-methylisoquinoline supports advanced research in drug discovery and organic synthesis.
| CAS Number | 1396762-45-0 |
| Molecular Formula | C10H7BrClN |
| Purity | ≥95% |
| IUPAC Name | 1-bromo-3-chloro-4-methylisoquinoline |
| InChI | InChI=1S/C10H7BrClN/c1-6-7-4-2-3-5-8(7)9(11)13-10(6)12/h2-5H,1H3 |
| InChIKey | MEDQCXWCTCXENA-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(C2=CC=CC=C12)Br)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |