For research use only. Not for therapeutic Use.
1-Bromo-3-(bromomethyl)-2-chlorobenzene(Cat No.:L018280)is a halogenated aromatic compound featuring bromine atoms at the 1 and 3 positions and a chlorine atom at the 2-position on a benzene ring. This compound is widely used in organic synthesis as a versatile building block for creating more complex molecules, particularly in pharmaceutical and agrochemical research. Its multiple halogen atoms enable various chemical transformations, making it valuable in developing bioactive compounds, intermediates, and advanced materials. 1-Bromo-3-(bromomethyl)-2-chlorobenzene is essential for researchers focused on innovative synthetic chemistry.
CAS Number | 1044256-89-4 |
Molecular Formula | C7H5Br2Cl |
Purity | ≥95% |
IUPAC Name | 1-bromo-3-(bromomethyl)-2-chlorobenzene |
InChI | InChI=1S/C7H5Br2Cl/c8-4-5-2-1-3-6(9)7(5)10/h1-3H,4H2 |
InChIKey | FJJLMWJGHJAMKW-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)Br)Cl)CBr |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |