For research use only. Not for therapeutic Use.
1-Bromo-2-methyl-4-(trifluoromethyl)benzene(Cat No.:L019910)is a halogenated aromatic compound featuring a bromine atom at position 1, a methyl group at position 2, and a trifluoromethyl group at position 4 on a benzene ring. This molecule is commonly used as an intermediate in organic synthesis, particularly in cross-coupling reactions such as Suzuki or Heck reactions. The trifluoromethyl group enhances lipophilicity and metabolic stability, making it valuable in pharmaceutical and agrochemical development. Its bromine functionality allows for efficient substitution or metalation, enabling construction of complex molecules in medicinal chemistry and materials science.
CAS Number | 929000-62-4 |
Molecular Formula | C8H6BrF3 |
Purity | ≥95% |
IUPAC Name | 1-bromo-2-methyl-4-(trifluoromethyl)benzene |
InChI | InChI=1S/C8H6BrF3/c1-5-4-6(8(10,11)12)2-3-7(5)9/h2-4H,1H3 |
InChIKey | NXHNLJDFFBZSKJ-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC(=C1)C(F)(F)F)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |