1-Bromo-2-iodobenzene - CAS 583-55-1
1-Bromo-2-iodobenzene (Cat.No:R063757) is a halogenated aromatic compound commonly used in organic synthesis and pharmaceutical research. Its unique bromine and iodine substituents make it a versatile building block for the creation of more complex molecules. 1-Bromo-2-iodobenzene finds applications in various chemical reactions and cross-coupling methodologies.
Catalog Number: R063757
CAS Number: 583-55-1
PubChem Substance ID:355071641
Molecular Formula: C6H4BrI
Molecular Weight:282.906
Purity: ≥95%
* For research use only. Not for human or veterinary use.
Synonym
Synonyms | 1-Iodo-2-bromobenzene; 2-Bromo-1-iodobenzene; 2-Bromoiodobenzene; 2-Bromophenyl iodide; 2-Iodo-1-bromobenzene; 2-Iodobromobenzene; o-Bromoiodobenzene; o-Bromophenyl iodide; o-Iodobromobenzene |
---|
Property
Molecular Formula: | C6H4BrI |
---|---|
Molecular Weight | 282.906 |
Purity | ≥95% |
Storage | 3 years -20C powder |
Computed Descriptor
IUPAC Name | 1-bromo-2-iodobenzene |
---|---|
InChI | InChI=1S/C6H4BrI/c7-5-3-1-2-4-6(5)8/h1-4H |
InChIKey | OIRHKGBNGGSCGS-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)Br)I |