For research use only. Not for therapeutic Use.
1-Bromo-2-chloro-3-fluoro-4-iodobenzene(Cat No.:L036167)is a highly halogenated aromatic compound featuring four different halogen substituents—bromine, chlorine, fluorine, and iodine—on a benzene ring. This densely functionalized molecule is valuable in organic synthesis as a versatile intermediate for selective cross-coupling and substitution reactions. Each halogen provides unique reactivity, allowing for sequential and orthogonal chemical modifications. Its structural complexity makes it useful in the development of advanced materials, pharmaceuticals, and radiolabeled compounds. The diverse electronic effects from the halogens also aid in tuning reactivity and properties in medicinal and materials chemistry applications.
| CAS Number | 1000573-03-4 |
| Molecular Formula | C6H2BrClFI |
| Purity | ≥95% |
| IUPAC Name | 1-bromo-2-chloro-3-fluoro-4-iodobenzene |
| InChI | InChI=1S/C6H2BrClFI/c7-3-1-2-4(10)6(9)5(3)8/h1-2H |
| InChIKey | KORMQSNUPWNOLD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Br)Cl)F)I |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |