For research use only. Not for therapeutic Use.
1-Bromo-2-bromomethyl-3-hydroxypropane(Cat No.:M011067)is a versatile chemical intermediate commonly used in organic synthesis, particularly in the pharmaceutical and agrochemical industries. This compound, characterized by two bromine atoms and a hydroxyl group attached to a propane backbone, offers unique reactivity for constructing complex molecular architectures. It is frequently employed in the synthesis of various active pharmaceutical ingredients (APIs) and fine chemicals, serving as a crucial building block in diverse chemical reactions. Its high purity and stability make it essential for researchers and chemists focused on innovative compound development and advanced synthesis projects.
CAS Number | 106023-63-6 |
Molecular Formula | C4H8Br2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-bromo-2-(bromomethyl)propan-1-ol |
InChI | InChI=1S/C4H8Br2O/c5-1-4(2-6)3-7/h4,7H,1-3H2 |
InChIKey | ZWDCXRWHPBYVKX-UHFFFAOYSA-N |
SMILES | C(C(CBr)CBr)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |