For research use only. Not for therapeutic Use.
1-BOC-4-ETHYL-4-PIPERIDINECARBOXYLIC ACID(CAT: M044264) is a significant intermediate in organic synthesis. Acting as a versatile building block, it is employed in the creation of diverse compounds. Its mode of action involves facilitating chemical reactions to form intricate molecular structures. Pharmacologically, it contributes to the development of various pharmaceuticals and agrochemicals. This compound finds applications across medicinal and chemical industries, playing a fundamental role in the synthesis of specialized molecules with potential applications ranging from drug development to crop protection.
CAS Number | 188792-67-8 |
Molecular Formula | C13H23NO4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-ethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
InChI | InChI=1S/C13H23NO4/c1-5-13(10(15)16)6-8-14(9-7-13)11(17)18-12(2,3)4/h5-9H2,1-4H3,(H,15,16) |
InChIKey | JEDALECUOKHQDK-UHFFFAOYSA-N |
SMILES | CCC1(CCN(CC1)C(=O)OC(C)(C)C)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |