Home
>
Chemical Reagents>Heterocyclic Building Blocks> 1-Boc-4-(4-Aminophenyl)piperazine dihydrochloride
For research use only. Not for therapeutic Use.
1-Boc-4-(4-Aminophenyl)piperazine dihydrochloride (Cat.No:L003631) is a pivotal compound in pharmaceutical research. Its unique structure, featuring a Boc-protected piperazine with an aminophenyl moiety, presents versatile pharmacological potential. This compound serves as a crucial intermediate in the synthesis of various pharmaceutical agents, highlighting its significance in drug development.
| CAS Number | 1187930-99-9 |
| Molecular Formula | C15H25Cl2N3O2 |
| Purity | ≥95% |
| IUPAC Name | tert-butyl 4-(4-aminophenyl)piperazine-1-carboxylate;dihydrochloride |
| InChI | InChI=1S/C15H23N3O2.2ClH/c1-15(2,3)20-14(19)18-10-8-17(9-11-18)13-6-4-12(16)5-7-13;;/h4-7H,8-11,16H2,1-3H3;2*1H |
| InChIKey | RXLNINVLZWODOG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CC=C(C=C2)N.Cl.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |