For research use only. Not for therapeutic Use.
1-Boc-4-(3-bromopropyl)piperidine (Cat No.:M138415) is a chemical compound widely used in organic synthesis and medicinal chemistry. It features a piperidine ring with a tert-butoxycarbonyl (Boc) protecting group on the nitrogen atom and a 3-bromopropyl substituent on one of the carbon atoms. This compound serves as a valuable intermediate for the synthesis of various organic molecules and pharmaceutical agents. Its reactivity and versatility make it an essential building block in drug development and research for creating diverse compounds with potential biological activities.
| CAS Number | 164149-27-3 |
| Molecular Formula | C13H24BrNO2 |
| Purity | ≥95% |
| Storage | Desiccate at -20°C |
| IUPAC Name | tert-butyl 4-(3-bromopropyl)piperidine-1-carboxylate |
| InChI | InChI=1S/C13H24BrNO2/c1-13(2,3)17-12(16)15-9-6-11(7-10-15)5-4-8-14/h11H,4-10H2,1-3H3 |
| InChIKey | ANKJSMCUWZFYKF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)CCCBr |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |