For research use only. Not for therapeutic Use.
1-Benzyl-5-(hydroxymethyl)piperidin-2-one(Cat No.:L038792)is a chemically modified piperidine derivative, notable for its benzyl and hydroxymethyl groups. This compound is essential in medicinal chemistry, particularly for synthesizing novel central nervous system (CNS) agents due to its piperidine backbone, a common feature in many pharmacological agents. The hydroxymethyl group allows for further functionalization, increasing the molecule’s versatility in organic synthesis. 1-Benzyl-5-(hydroxymethyl)piperidin-2-one serves as a key intermediate in the development of drugs targeting neurological disorders, enhancing the potential for creating effective therapeutic agents with improved pharmacodynamic properties.
CAS Number | 744212-68-8 |
Molecular Formula | C13H17NO2 |
Purity | ≥95% |
IUPAC Name | 1-benzyl-5-(hydroxymethyl)piperidin-2-one |
InChI | InChI=1S/C13H17NO2/c15-10-12-6-7-13(16)14(9-12)8-11-4-2-1-3-5-11/h1-5,12,15H,6-10H2 |
InChIKey | LRMCTXDLWPUNPF-UHFFFAOYSA-N |
SMILES | C1CC(=O)N(CC1CO)CC2=CC=CC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |