For research use only. Not for therapeutic Use.
1-Benzyl-3,3-dimethylpiperidin-4-one (Cat.No:M041950) is a chemical compound with diverse applications. It serves as a key intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its piperidinone structure imparts significant pharmacological potential, making it valuable in medicinal chemistry research and the development of new therapeutic agents.
| CAS Number | 173186-91-9 |
| Molecular Formula | C14H19NO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-benzyl-3,3-dimethylpiperidin-4-one |
| InChI | InChI=1S/C14H19NO/c1-14(2)11-15(9-8-13(14)16)10-12-6-4-3-5-7-12/h3-7H,8-11H2,1-2H3 |
| InChIKey | YKQMBPQMCWGNDY-UHFFFAOYSA-N |
| SMILES | CC1(CN(CCC1=O)CC2=CC=CC=C2)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |