Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 1-Benzyl-3-phenylpiperidin-4-one
For research use only. Not for therapeutic Use.
1-Benzyl-3-phenylpiperidin-4-one (Cat No.:L011962) is a chemical compound with a piperidine-4-one ring substituted by a benzyl group at the 1-position and a phenyl group at the 3-position. This compound may have applications in organic synthesis and medicinal chemistry, serving as a valuable intermediate for creating more complex molecules. The presence of both the benzyl and phenyl groups adds specific chemical properties, potentially relevant for drug design and development.
| CAS Number | 446302-83-6 |
| Molecular Formula | C18H19NO |
| Purity | ≥95% |
| Storage | 2-8°C |
| IUPAC Name | 1-benzyl-3-phenylpiperidin-4-one |
| InChI | InChI=1S/C18H19NO/c20-18-11-12-19(13-15-7-3-1-4-8-15)14-17(18)16-9-5-2-6-10-16/h1-10,17H,11-14H2 |
| InChIKey | VDRJIVUPMPNZBO-UHFFFAOYSA-N |
| SMILES | C1CN(CC(C1=O)C2=CC=CC=C2)CC3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |