For research use only. Not for therapeutic Use.
1-(Benzofuran-6-yl)ethanone is an organic compound featuring a benzofuran ring attached to an ethanone group at the 6-position. It is commonly used as an intermediate in pharmaceutical research and organic synthesis, particularly in the development of bioactive molecules and drug candidates. The benzofuran structure provides a versatile platform for chemical modifications, allowing for the creation of complex compounds. This compound contributes to advancements in medicinal chemistry, supporting the synthesis of therapeutic agents and other fine chemicals.
| CAS Number | 865760-13-0 |
| Molecular Formula | C10H8O2 |
| Purity | ≥95% |
| IUPAC Name | 1-(1-benzofuran-6-yl)ethanone |
| InChI | InChI=1S/C10H8O2/c1-7(11)9-3-2-8-4-5-12-10(8)6-9/h2-6H,1H3 |
| InChIKey | OZSFNSCLJFRYPC-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
