Home
>
Reference Standards>Heterocyclic Building Blocks> (1-Azabicyclo[2.2.2]oct-4-yl)(diphenyl)methanol
For research use only. Not for therapeutic Use.
(1-Azabicyclo[2.2.2]oct-4-yl)(diphenyl)methanol is a synthetic organic compound featuring a bicyclic azabicyclo[2.2.2]octane structure with a diphenylmethanol moiety. The rigid bicyclic framework, combined with the diphenylmethanol group, makes this compound valuable in medicinal chemistry, particularly as a potential intermediate in the synthesis of bioactive molecules or pharmaceutical agents. Compounds with similar structures are often investigated for their ability to interact with various receptors in the central nervous system, potentially acting as anticholinergic or neuromodulating agents. Its unique structure allows for diverse functionalization, making it useful in drug development and pharmacological research.
| CAS Number | 461648-39-5 |
| Synonyms | α,α-Diphenyl-1-azabicyclo[2.2.2]octane-4-methanol? |
| Molecular Formula | C20H23NO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-4-yl(diphenyl)methanol |
| InChI | InChI=1S/C20H23NO/c22-20(17-7-3-1-4-8-17,18-9-5-2-6-10-18)19-11-14-21(15-12-19)16-13-19/h1-10,22H,11-16H2 |
| InChIKey | VUUAKOZGGDHCRP-UHFFFAOYSA-N |
| SMILES | C1CN2CCC1(CC2)C(C3=CC=CC=C3)(C4=CC=CC=C4)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |