For research use only. Not for therapeutic Use.
1-Amino-2-propanol (Cat No.: R020019) is a colorless, water-soluble organic compound with both amine and alcohol functional groups, classifying it as an amino alcohol. It has the molecular formula C₃H₉NO and features a primary amine on the first carbon and a hydroxyl group on the second. It is commonly used as a building block in the synthesis of pharmaceuticals, surfactants, and corrosion inhibitors. Its bifunctional nature allows it to participate in various chemical reactions, including esterification, amidation, and condensation processes in industrial and laboratory settings.
| CAS Number | 78-96-6 |
| Synonyms | (2-Hydroxy-2-methylethyl)amine; (RS)-1-Amino-2-hydroxypropane; (RS)-1-amino-2-propanol; (±)-1-Amino-2-propanol; 1-Amino-2-hydroxypropane; 1-Amino-2-propanol; 1-Methyl-2-aminoethanol; 2-Amino-1-methylethanol; 2-Hydroxy-1-propanamine; 2-Hydroxy-1-propy |
| Molecular Formula | C3H9NO |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | -20°C |
| IUPAC Name | 1-aminopropan-2-ol |
| InChI | InChI=1S/C3H9NO/c1-3(5)2-4/h3,5H,2,4H2,1H3 |
| InChIKey | HXKKHQJGJAFBHI-UHFFFAOYSA-N |
| SMILES | CC(CN)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |