For research use only. Not for therapeutic Use.
1-(6-(Trifluoromethyl)pyridin-3-yl)ethanol(CAT: L029045) is a high-purity compound featuring a trifluoromethyl-substituted pyridine ring and a hydroxyl functional group. This versatile molecule serves as a valuable building block in pharmaceutical and chemical research, particularly for synthesizing bioactive compounds and fine chemicals. Its unique structure is instrumental in developing novel therapeutics, enabling studies in medicinal chemistry and structure-activity relationships. With exceptional stability and reactivity, 1-(6-(Trifluoromethyl)pyridin-3-yl)ethanol is ideal for precision-driven research, offering reliability and adaptability across diverse experimental protocols and innovative synthesis projects.
CAS Number | 1228631-54-6 |
Molecular Formula | C8H8F3NO |
Purity | ≥95% |
IUPAC Name | 1-[6-(trifluoromethyl)pyridin-3-yl]ethanol |
InChI | InChI=1S/C8H8F3NO/c1-5(13)6-2-3-7(12-4-6)8(9,10)11/h2-5,13H,1H3 |
InChIKey | JGVSFNXTWYOUFV-UHFFFAOYSA-N |
SMILES | CC(C1=CN=C(C=C1)C(F)(F)F)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |