Home
>
Chemical Reagents>Heterocyclic Building Blocks>
>
1-(4-Methylpiperidin-4-yl)ethanone hydrochloride
1-(4-Methylpiperidin-4-yl)ethanone hydrochloride(CAT: L000027)is a chemical compound of significance in pharmaceutical and organic chemistry. In the pharmaceutical field, it serves as a key intermediate in the synthesis of various medications, impacting specific biological targets. Its action method involves its incorporation into drug molecules, contributing to the development of novel medications.
Catalog Number | L000027 |
CAS Number | 2566476-29-5 |
Molecular Formula | C8H16ClNO |
Purity | 95% |
IUPAC Name | 1-(4-methylpiperidin-4-yl)ethanone;hydrochloride |
InChI | InChI=1S/C8H15NO.ClH/c1-7(10)8(2)3-5-9-6-4-8;/h9H,3-6H2,1-2H3;1H |
InChIKey | XBQFJZKMQOCQMK-UHFFFAOYSA-N |